C20H23N5OS — CID 40696855
1-(3,5-dimethylphenyl)-3-[[2-(2-ethylbenzimidazol-1-yl)acetyl]amino]thiourea (PubChem CID 40696855) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[[2-(2-ethylbenzimidazol-1-yl)acetyl]amino]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[[2-(2-ethylbenzimidazol-1-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 40696855 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[[2-(2-ethylbenzimidazol-1-yl)acetyl]amino]thiourea |
| SMILES | CCc1nc2ccccc2n1CC(=O)NNC(=S)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C20H23N5OS/c1-4-18-22-16-7-5-6-8-17(16)25(18)12-19(26)23-24-20(27)21-15-10-13(2)9-14(3)11-15/h5-11H,4,12H2,1-3H3,(H,23,26)(H2,21,24,27) |
| InChIKey | MZMYYRZQTIRNIM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|