C16H22N4O2S — CID 99805786
(2R)-N'-[2-(2-ethylbenzimidazol-1-yl)acetyl]-2-methyl-3-methylsulfanylpropanehydrazide (PubChem CID 99805786) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is (2R)-N'-[2-(2-ethylbenzimidazol-1-yl)acetyl]-2-methyl-3-methylsulfanylpropanehydrazide.
| Compound Name | (2R)-N'-[2-(2-ethylbenzimidazol-1-yl)acetyl]-2-methyl-3-methylsulfanylpropanehydrazide |
|---|---|
| PubChem CID | 99805786 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (2R)-N'-[2-(2-ethylbenzimidazol-1-yl)acetyl]-2-methyl-3-methylsulfanylpropanehydrazide |
| SMILES | CCc1nc2ccccc2n1CC(=O)NNC(=O)[C@@H](C)CSC |
| InChI | InChI=1S/C16H22N4O2S/c1-4-14-17-12-7-5-6-8-13(12)20(14)9-15(21)18-19-16(22)11(2)10-23-3/h5-8,11H,4,9-10H2,1-3H3,(H,18,21)(H,19,22)/t11-/m0/s1 |
| InChIKey | APYKFAXASRATPL-NSHDSACASA-N |
| XLogP | 1.75 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|