C19H20N2O2S — CID 40697618
4-ethoxy-N-(3,5,6-trimethyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 40697618) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is 4-ethoxy-N-(3,5,6-trimethyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-ethoxy-N-(3,5,6-trimethyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 40697618 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 4-ethoxy-N-(3,5,6-trimethyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | CCOc1ccc(C(=O)/N=c2\sc3cc(C)c(C)cc3n2C)cc1 |
| InChI | InChI=1S/C19H20N2O2S/c1-5-23-15-8-6-14(7-9-15)18(22)20-19-21(4)16-10-12(2)13(3)11-17(16)24-19/h6-11H,5H2,1-4H3/b20-19- |
| InChIKey | CNLVILFCKRQZJH-VXPUYCOJSA-N |
| XLogP | 4.00 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |