C23H34ClN3O2 — CID 40709587
2-[4-(4-tert-butylcyclohexanecarbonyl)piperazin-1-yl]-N-(2-chlorophenyl)acetamide (PubChem CID 40709587) has the molecular formula C23H34ClN3O2 and a molecular weight of 420.00 g/mol. Its IUPAC name is 2-[4-(4-tert-butylcyclohexanecarbonyl)piperazin-1-yl]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[4-(4-tert-butylcyclohexanecarbonyl)piperazin-1-yl]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 40709587 |
| Molecular Formula | C23H34ClN3O2 |
| Molecular Weight | 420.00 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 2-[4-(4-tert-butylcyclohexanecarbonyl)piperazin-1-yl]-N-(2-chlorophenyl)acetamide |
| SMILES | CC(C)(C)C1CCC(C(=O)N2CCN(CC(=O)Nc3ccccc3Cl)CC2)CC1 |
| InChI | InChI=1S/C23H34ClN3O2/c1-23(2,3)18-10-8-17(9-11-18)22(29)27-14-12-26(13-15-27)16-21(28)25-20-7-5-4-6-19(20)24/h4-7,17-18H,8-16H2,1-3H3,(H,25,28) |
| InChIKey | RSSZEWANYGQNJO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.00 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |