C21H16ClN3O — CID 40714258
5-[(R)-(4-chlorophenyl)-(pyridin-2-ylamino)methyl]quinolin-6-ol (PubChem CID 40714258) has the molecular formula C21H16ClN3O and a molecular weight of 361.83 g/mol. Its IUPAC name is 5-[(R)-(4-chlorophenyl)-(pyridin-2-ylamino)methyl]quinolin-6-ol.
| Compound Name | 5-[(R)-(4-chlorophenyl)-(pyridin-2-ylamino)methyl]quinolin-6-ol |
|---|---|
| PubChem CID | 40714258 |
| Molecular Formula | C21H16ClN3O |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 5-[(R)-(4-chlorophenyl)-(pyridin-2-ylamino)methyl]quinolin-6-ol |
| SMILES | Oc1ccc2ncccc2c1[C@H](Nc1ccccn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16ClN3O/c22-15-8-6-14(7-9-15)21(25-19-5-1-2-12-24-19)20-16-4-3-13-23-17(16)10-11-18(20)26/h1-13,21,26H,(H,24,25)/t21-/m1/s1 |
| InChIKey | LPRHGBLPNRTUEF-OAQYLSRUSA-N |
| XLogP | 5.19 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|