C25H22ClN3O — CID 40714252
5-[(R)-(4-chlorophenyl)-(pyridin-2-ylamino)methyl]-2-methyl-7-prop-2-enylquinolin-8-ol (PubChem CID 40714252) has the molecular formula C25H22ClN3O and a molecular weight of 415.92 g/mol. Its IUPAC name is 5-[(R)-(4-chlorophenyl)-(pyridin-2-ylamino)methyl]-2-methyl-7-prop-2-enylquinolin-8-ol.
| Compound Name | 5-[(R)-(4-chlorophenyl)-(pyridin-2-ylamino)methyl]-2-methyl-7-prop-2-enylquinolin-8-ol |
|---|---|
| PubChem CID | 40714252 |
| Molecular Formula | C25H22ClN3O |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 5-[(R)-(4-chlorophenyl)-(pyridin-2-ylamino)methyl]-2-methyl-7-prop-2-enylquinolin-8-ol |
| SMILES | C=CCc1cc([C@H](Nc2ccccn2)c2ccc(Cl)cc2)c2ccc(C)nc2c1O |
| InChI | InChI=1S/C25H22ClN3O/c1-3-6-18-15-21(20-13-8-16(2)28-24(20)25(18)30)23(17-9-11-19(26)12-10-17)29-22-7-4-5-14-27-22/h3-5,7-15,23,30H,1,6H2,2H3,(H,27,29)/t23-/m1/s1 |
| InChIKey | QICPNRBBAUUSCA-HSZRJFAPSA-N |
| XLogP | 6.23 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|