C20H31N3O — CID 40726754
N-[(1R)-1-(1-adamantyl)propyl]-1,3,5-trimethylpyrazole-4-carboxamide (PubChem CID 40726754) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is N-[(1R)-1-(1-adamantyl)propyl]-1,3,5-trimethylpyrazole-4-carboxamide.
| Compound Name | N-[(1R)-1-(1-adamantyl)propyl]-1,3,5-trimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 40726754 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | N-[(1R)-1-(1-adamantyl)propyl]-1,3,5-trimethylpyrazole-4-carboxamide |
| SMILES | CC[C@@H](NC(=O)c1c(C)nn(C)c1C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H31N3O/c1-5-17(21-19(24)18-12(2)22-23(4)13(18)3)20-9-14-6-15(10-20)8-16(7-14)11-20/h14-17H,5-11H2,1-4H3,(H,21,24)/t14?,15?,16?,17-,20?/m1/s1 |
| InChIKey | HLBOHNHOLHSXNH-VQBCORBOSA-N |
| XLogP | 3.76 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |