C21H34N4O — CID 95032727
1-[(1R)-1-(1-adamantyl)ethyl]-3-[(1R)-1-(1,3,5-trimethylpyrazol-4-yl)ethyl]urea (PubChem CID 95032727) has the molecular formula C21H34N4O and a molecular weight of 358.53 g/mol. Its IUPAC name is 1-[(1R)-1-(1-adamantyl)ethyl]-3-[(1R)-1-(1,3,5-trimethylpyrazol-4-yl)ethyl]urea.
| Compound Name | 1-[(1R)-1-(1-adamantyl)ethyl]-3-[(1R)-1-(1,3,5-trimethylpyrazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 95032727 |
| Molecular Formula | C21H34N4O |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 1-[(1R)-1-(1-adamantyl)ethyl]-3-[(1R)-1-(1,3,5-trimethylpyrazol-4-yl)ethyl]urea |
| SMILES | Cc1nn(C)c(C)c1[C@@H](C)NC(=O)N[C@H](C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H34N4O/c1-12(19-13(2)24-25(5)14(19)3)22-20(26)23-15(4)21-9-16-6-17(10-21)8-18(7-16)11-21/h12,15-18H,6-11H2,1-5H3,(H2,22,23,26)/t12-,15-,16?,17?,18?,21?/m1/s1 |
| InChIKey | XUHWJFDASOPIRJ-KUPHYXKRSA-N |
| XLogP | 4.00 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |