C17H24N4O — CID 60595650
1-(1-phenylethyl)-3-[1-(1,3,5-trimethylpyrazol-4-yl)ethyl]urea (PubChem CID 60595650) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 1-(1-phenylethyl)-3-[1-(1,3,5-trimethylpyrazol-4-yl)ethyl]urea.
| Compound Name | 1-(1-phenylethyl)-3-[1-(1,3,5-trimethylpyrazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 60595650 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 1-(1-phenylethyl)-3-[1-(1,3,5-trimethylpyrazol-4-yl)ethyl]urea |
| SMILES | Cc1nn(C)c(C)c1C(C)NC(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C17H24N4O/c1-11(15-9-7-6-8-10-15)18-17(22)19-12(2)16-13(3)20-21(5)14(16)4/h6-12H,1-5H3,(H2,18,19,22) |
| InChIKey | IKLLEDNGHPXXPH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |