C40H38N2O5S — CID 4072744
N-[3-[4-[[anthracen-9-ylmethyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]benzenesulfonamide (PubChem CID 4072744) has the molecular formula C40H38N2O5S and a molecular weight of 658.82 g/mol. Its IUPAC name is N-[3-[4-[[anthracen-9-ylmethyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]benzenesulfonamide.
| Compound Name | N-[3-[4-[[anthracen-9-ylmethyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4072744 |
| Molecular Formula | C40H38N2O5S |
| Molecular Weight | 658.82 g/mol |
| Exact Mass | 658.25 |
| IUPAC Name | N-[3-[4-[[anthracen-9-ylmethyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]benzenesulfonamide |
| SMILES | CN(Cc1c2ccccc2cc2ccccc12)CC1CC(c2ccc(CO)cc2)OC(c2cccc(NS(=O)(=O)c3ccccc3)c2)O1 |
| InChI | InChI=1S/C40H38N2O5S/c1-42(26-38-36-16-7-5-10-30(36)22-31-11-6-8-17-37(31)38)25-34-24-39(29-20-18-28(27-43)19-21-29)47-40(46-34)32-12-9-13-33(23-32)41-48(44,45)35-14-3-2-4-15-35/h2-23,34,39-41,43H,24-27H2,1H3 |
| InChIKey | KZDCWYXSGOKDAA-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.82 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|