C36H48N2O10S — CID 6680105
N-[3-[(4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)-1,3-dioxan-2-yl]phenyl]benzenesulfonamide (PubChem CID 6680105) has the molecular formula C36H48N2O10S and a molecular weight of 700.85 g/mol. Its IUPAC name is N-[3-[(4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)-1,3-dioxan-2-yl]phenyl]benzenesulfonamide.
| Compound Name | N-[3-[(4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)-1,3-dioxan-2-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6680105 |
| Molecular Formula | C36H48N2O10S |
| Molecular Weight | 700.85 g/mol |
| Exact Mass | 700.30 |
| IUPAC Name | N-[3-[(4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)-1,3-dioxan-2-yl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(C2O[C@H](CN3CCOCCOCCOCCOCCOCC3)C[C@H](c3ccc(CO)cc3)O2)c1)c1ccccc1 |
| InChI | InChI=1S/C36H48N2O10S/c39-28-29-9-11-30(12-10-29)35-26-33(27-38-13-15-42-17-19-44-21-23-46-24-22-45-20-18-43-16-14-38)47-36(48-35)31-5-4-6-32(25-31)37-49(40,41)34-7-2-1-3-8-34/h1-12,25,33,35-37,39H,13-24,26-28H2/t33-,35+,36?/m0/s1 |
| InChIKey | IDCLHWLGIXLZER-FUOMJERPSA-N |
| XLogP | 3.92 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.85 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |