C39H46N2O12 — CID 6680107
N-[3-[(4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)-1,3-dioxan-2-yl]phenyl]-1,3-dioxo-2-benzofuran-5-carboxamide (PubChem CID 6680107) has the molecular formula C39H46N2O12 and a molecular weight of 734.80 g/mol. Its IUPAC name is N-[3-[(4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)-1,3-dioxan-2-yl]phenyl]-1,3-dioxo-2-benzofuran-5-carboxamide.
| Compound Name | N-[3-[(4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)-1,3-dioxan-2-yl]phenyl]-1,3-dioxo-2-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 6680107 |
| Molecular Formula | C39H46N2O12 |
| Molecular Weight | 734.80 g/mol |
| Exact Mass | 734.31 |
| IUPAC Name | N-[3-[(4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)-1,3-dioxan-2-yl]phenyl]-1,3-dioxo-2-benzofuran-5-carboxamide |
| SMILES | O=C(Nc1cccc(C2O[C@H](CN3CCOCCOCCOCCOCCOCC3)C[C@H](c3ccc(CO)cc3)O2)c1)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C39H46N2O12/c42-26-27-4-6-28(7-5-27)35-24-32(25-41-10-12-46-14-16-48-18-20-50-21-19-49-17-15-47-13-11-41)51-39(52-35)30-2-1-3-31(22-30)40-36(43)29-8-9-33-34(23-29)38(45)53-37(33)44/h1-9,22-23,32,35,39,42H,10-21,24-26H2,(H,40,43)/t32-,35+,39?/m0/s1 |
| InChIKey | HSSPGFMFYIQMBJ-DUCOJKTGSA-N |
| XLogP | 3.69 |
| TPSA | 160.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.80 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|