C35H38N2O7 — CID 6680514
N-[3-[(4S,5R,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-1,3-dioxo-2-benzofuran-5-carboxamide (PubChem CID 6680514) has the molecular formula C35H38N2O7 and a molecular weight of 598.70 g/mol. Its IUPAC name is N-[3-[(4S,5R,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-1,3-dioxo-2-benzofuran-5-carboxamide.
| Compound Name | N-[3-[(4S,5R,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-1,3-dioxo-2-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 6680514 |
| Molecular Formula | C35H38N2O7 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.27 |
| IUPAC Name | N-[3-[(4S,5R,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-1,3-dioxo-2-benzofuran-5-carboxamide |
| SMILES | C[C@H]1[C@@H](CN2CCCCCCC2)OC(c2cccc(NC(=O)c3ccc4c(c3)C(=O)OC4=O)c2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C35H38N2O7/c1-22-30(20-37-16-5-3-2-4-6-17-37)42-35(43-31(22)24-12-10-23(21-38)11-13-24)26-8-7-9-27(18-26)36-32(39)25-14-15-28-29(19-25)34(41)44-33(28)40/h7-15,18-19,22,30-31,35,38H,2-6,16-17,20-21H2,1H3,(H,36,39)/t22-,30+,31+,35?/m0/s1 |
| InChIKey | KYHXVXGVMMMQPT-OHUGGIKOSA-N |
| XLogP | 5.80 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|