C41H42N2O7 — CID 6680844
N-[[4-[(4S,5S,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-phenyl-1,3-dioxan-2-yl]phenyl]methyl]-1,3-dioxo-2-benzofuran-5-carboxamide (PubChem CID 6680844) has the molecular formula C41H42N2O7 and a molecular weight of 674.79 g/mol. Its IUPAC name is N-[[4-[(4S,5S,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-phenyl-1,3-dioxan-2-yl]phenyl]methyl]-1,3-dioxo-2-benzofuran-5-carboxamide.
| Compound Name | N-[[4-[(4S,5S,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-phenyl-1,3-dioxan-2-yl]phenyl]methyl]-1,3-dioxo-2-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 6680844 |
| Molecular Formula | C41H42N2O7 |
| Molecular Weight | 674.79 g/mol |
| Exact Mass | 674.30 |
| IUPAC Name | N-[[4-[(4S,5S,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-phenyl-1,3-dioxan-2-yl]phenyl]methyl]-1,3-dioxo-2-benzofuran-5-carboxamide |
| SMILES | O=C(NCc1ccc(C2O[C@H](CN3CCCCCCC3)C(c3ccccc3)[C@H](c3ccc(CO)cc3)O2)cc1)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C41H42N2O7/c44-26-28-13-15-30(16-14-28)37-36(29-9-5-4-6-10-29)35(25-43-21-7-2-1-3-8-22-43)48-41(49-37)31-17-11-27(12-18-31)24-42-38(45)32-19-20-33-34(23-32)40(47)50-39(33)46/h4-6,9-20,23,35-37,41,44H,1-3,7-8,21-22,24-26H2,(H,42,45)/t35-,36?,37+,41?/m1/s1 |
| InChIKey | GCQTURPZJSHVCV-WMEJHSNSSA-N |
| XLogP | 6.62 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.79 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|