C31H30N2O7 — CID 6679788
N-[3-[(4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]-1,3-dioxo-2-benzofuran-5-carboxamide (PubChem CID 6679788) has the molecular formula C31H30N2O7 and a molecular weight of 542.59 g/mol. Its IUPAC name is N-[3-[(4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]-1,3-dioxo-2-benzofuran-5-carboxamide.
| Compound Name | N-[3-[(4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]-1,3-dioxo-2-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 6679788 |
| Molecular Formula | C31H30N2O7 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | N-[3-[(4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]-1,3-dioxo-2-benzofuran-5-carboxamide |
| SMILES | C=CCN(C)C[C@@H]1C[C@H](c2ccc(CO)cc2)OC(c2cccc(NC(=O)c3ccc4c(c3)C(=O)OC4=O)c2)O1 |
| InChI | InChI=1S/C31H30N2O7/c1-3-13-33(2)17-24-16-27(20-9-7-19(18-34)8-10-20)39-31(38-24)22-5-4-6-23(14-22)32-28(35)21-11-12-25-26(15-21)30(37)40-29(25)36/h3-12,14-15,24,27,31,34H,1,13,16-18H2,2H3,(H,32,35)/t24-,27+,31?/m0/s1 |
| InChIKey | RGCLDOIQZOFMBJ-YZTXBMTJSA-N |
| XLogP | 4.41 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|