C26H40N2O4 — CID 40731593
2-[N-[6-[1-(2,6-dioxocyclohexyl)butylideneamino]hexyl]-C-propylcarbonimidoyl]cyclohexane-1,3-dione (PubChem CID 40731593) has the molecular formula C26H40N2O4 and a molecular weight of 444.62 g/mol. Its IUPAC name is 2-[N-[6-[1-(2,6-dioxocyclohexyl)butylideneamino]hexyl]-C-propylcarbonimidoyl]cyclohexane-1,3-dione.
| Compound Name | 2-[N-[6-[1-(2,6-dioxocyclohexyl)butylideneamino]hexyl]-C-propylcarbonimidoyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 40731593 |
| Molecular Formula | C26H40N2O4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | 2-[N-[6-[1-(2,6-dioxocyclohexyl)butylideneamino]hexyl]-C-propylcarbonimidoyl]cyclohexane-1,3-dione |
| SMILES | CCC/C(=N\CCCCCC/N=C(\CCC)C1C(=O)CCCC1=O)C1C(=O)CCCC1=O |
| InChI | InChI=1S/C26H40N2O4/c1-3-11-19(25-21(29)13-9-14-22(25)30)27-17-7-5-6-8-18-28-20(12-4-2)26-23(31)15-10-16-24(26)32/h25-26H,3-18H2,1-2H3/b27-19+,28-20+ |
| InChIKey | APPDACCLYUWKBS-MKYUKRCKSA-N |
| XLogP | 4.91 |
| TPSA | 93.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|