C16H25NO2 — CID 54225194
5-methyl-2-(4-methyl-2,3,4,5-tetrahydropyridin-6-yl)-5-propan-2-ylcyclohexane-1,3-dione (PubChem CID 54225194) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 5-methyl-2-(4-methyl-2,3,4,5-tetrahydropyridin-6-yl)-5-propan-2-ylcyclohexane-1,3-dione.
| Compound Name | 5-methyl-2-(4-methyl-2,3,4,5-tetrahydropyridin-6-yl)-5-propan-2-ylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 54225194 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 5-methyl-2-(4-methyl-2,3,4,5-tetrahydropyridin-6-yl)-5-propan-2-ylcyclohexane-1,3-dione |
| SMILES | CC1CCN=C(C2C(=O)CC(C)(C(C)C)CC2=O)C1 |
| InChI | InChI=1S/C16H25NO2/c1-10(2)16(4)8-13(18)15(14(19)9-16)12-7-11(3)5-6-17-12/h10-11,15H,5-9H2,1-4H3 |
| InChIKey | QFJAIUKXMKRVCL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|