C28H28ClN5O — CID 40732492
1-[(3S)-2-(4-chlorophenyl)-4-[4-(diethylamino)phenyl]-3-(1H-indol-3-yl)-3H-1,2,4-triazol-5-yl]ethanone (PubChem CID 40732492) has the molecular formula C28H28ClN5O and a molecular weight of 486.02 g/mol. Its IUPAC name is 1-[(3S)-2-(4-chlorophenyl)-4-[4-(diethylamino)phenyl]-3-(1H-indol-3-yl)-3H-1,2,4-triazol-5-yl]ethanone.
| Compound Name | 1-[(3S)-2-(4-chlorophenyl)-4-[4-(diethylamino)phenyl]-3-(1H-indol-3-yl)-3H-1,2,4-triazol-5-yl]ethanone |
|---|---|
| PubChem CID | 40732492 |
| Molecular Formula | C28H28ClN5O |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 1-[(3S)-2-(4-chlorophenyl)-4-[4-(diethylamino)phenyl]-3-(1H-indol-3-yl)-3H-1,2,4-triazol-5-yl]ethanone |
| SMILES | CCN(CC)c1ccc(N2C(C(C)=O)=NN(c3ccc(Cl)cc3)[C@H]2c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C28H28ClN5O/c1-4-32(5-2)21-14-16-22(17-15-21)33-27(19(3)35)31-34(23-12-10-20(29)11-13-23)28(33)25-18-30-26-9-7-6-8-24(25)26/h6-18,28,30H,4-5H2,1-3H3/t28-/m0/s1 |
| InChIKey | JOFWANIXBKWXLC-NDEPHWFRSA-N |
| XLogP | 6.60 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|