About [(2R)-4-chloro-5-oxo-3-(4-phenoxyanilino)-2H-furan-2-yl] 2-methylbenzoate
[(2R)-4-chloro-5-oxo-3-(4-phenoxyanilino)-2H-furan-2-yl] 2-methylbenzoate (PubChem CID 40733292) has the molecular formula C24H18ClNO5
and a molecular weight of 435.86 g/mol. Its IUPAC name is [(2R)-4-chloro-5-oxo-3-(4-phenoxyanilino)-2H-furan-2-yl] 2-methylbenzoate.
Molecular Properties
| Compound Name | [(2R)-4-chloro-5-oxo-3-(4-phenoxyanilino)-2H-furan-2-yl] 2-methylbenzoate |
| PubChem CID | 40733292 |
| Molecular Formula | C24H18ClNO5 |
| Molecular Weight | 435.86 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | [(2R)-4-chloro-5-oxo-3-(4-phenoxyanilino)-2H-furan-2-yl] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)O[C@@H]1OC(=O)C(Cl)=C1Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C24H18ClNO5/c1-15-7-5-6-10-19(15)22(27)30-24-21(20(25)23(28)31-24)26-16-11-13-18(14-12-16)29-17-8-3-2-4-9-17/h2-14,24,26H,1H3/t24-/m1/s1 |
| InChIKey | BLEXJRRHKCGDJC-XMMPIXPASA-N |
| XLogP | 5.39 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.86 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(2R)-4-chloro-5-oxo-3-(4-phenoxyanilino)-2H-furan-2-yl] 2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-4-chloro-5-oxo-3-(4-phenoxyanilino)-2H-furan-2-yl] 2-methylbenzoate?
The IUPAC name of [(2R)-4-chloro-5-oxo-3-(4-phenoxyanilino)-2H-furan-2-yl] 2-methylbenzoate (CID 40733292) is [(2R)-4-chloro-5-oxo-3-(4-phenoxyanilino)-2H-furan-2-yl] 2-methylbenzoate.
What is the SMILES notation for [(2R)-4-chloro-5-oxo-3-(4-phenoxyanilino)-2H-furan-2-yl] 2-methylbenzoate?
The canonical SMILES for [(2R)-4-chloro-5-oxo-3-(4-phenoxyanilino)-2H-furan-2-yl] 2-methylbenzoate is Cc1ccccc1C(=O)O[C@@H]1OC(=O)C(Cl)=C1Nc1ccc(Oc2ccccc2)cc1.
What is the InChIKey of [(2R)-4-chloro-5-oxo-3-(4-phenoxyanilino)-2H-furan-2-yl] 2-methylbenzoate?
The InChIKey is BLEXJRRHKCGDJC-XMMPIXPASA-N. The full InChI is InChI=1S/C24H18ClNO5/c1-15-7-5-6-10-19(15)22(27)30-24-21(20(25)23(28)31-24)26-16-11-13-18(14-12-16)29-17-8-3-2-4-9-17/h2-14,24,26H,1H3/t24-/m1/s1.
What are the key properties of [(2R)-4-chloro-5-oxo-3-(4-phenoxyanilino)-2H-furan-2-yl] 2-methylbenzoate?
[(2R)-4-chloro-5-oxo-3-(4-phenoxyanilino)-2H-furan-2-yl] 2-methylbenzoate has a molecular weight of 435.86 g/mol, XLogP of 5.39, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-4-chloro-5-oxo-3-(4-phenoxyanilino)-2H-furan-2-yl] 2-methylbenzoate is sourced from PubChem (CID 40733292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).