C18H14F2N2O2S — CID 40738951
3,4-difluoro-N-[(R)-phenyl(pyridin-4-yl)methyl]benzenesulfonamide (PubChem CID 40738951) has the molecular formula C18H14F2N2O2S and a molecular weight of 360.39 g/mol. Its IUPAC name is 3,4-difluoro-N-[(R)-phenyl(pyridin-4-yl)methyl]benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-[(R)-phenyl(pyridin-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 40738951 |
| Molecular Formula | C18H14F2N2O2S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 3,4-difluoro-N-[(R)-phenyl(pyridin-4-yl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@H](c1ccccc1)c1ccncc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H14F2N2O2S/c19-16-7-6-15(12-17(16)20)25(23,24)22-18(13-4-2-1-3-5-13)14-8-10-21-11-9-14/h1-12,18,22H/t18-/m1/s1 |
| InChIKey | XBWOVSFBYCCDJU-GOSISDBHSA-N |
| XLogP | 3.43 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |