C19H19N3O2S — CID 142157498
3,4-diamino-N-benzhydrylbenzenesulfonamide (PubChem CID 142157498) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is 3,4-diamino-N-benzhydrylbenzenesulfonamide.
| Compound Name | 3,4-diamino-N-benzhydrylbenzenesulfonamide |
|---|---|
| PubChem CID | 142157498 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 3,4-diamino-N-benzhydrylbenzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NC(c2ccccc2)c2ccccc2)cc1N |
| InChI | InChI=1S/C19H19N3O2S/c20-17-12-11-16(13-18(17)21)25(23,24)22-19(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13,19,22H,20-21H2 |
| InChIKey | DANHQXZTJCYXFH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|