C12H9N4O2+ — CID 4074899
2-(4-nitrophenyl)-1H-imidazo[1,2-a]pyrimidin-4-ium (PubChem CID 4074899) has the molecular formula C12H9N4O2+ and a molecular weight of 241.23 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-1H-imidazo[1,2-a]pyrimidin-4-ium.
| Compound Name | 2-(4-nitrophenyl)-1H-imidazo[1,2-a]pyrimidin-4-ium |
|---|---|
| PubChem CID | 4074899 |
| Molecular Formula | C12H9N4O2+ |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-(4-nitrophenyl)-1H-imidazo[1,2-a]pyrimidin-4-ium |
| SMILES | O=[N+]([O-])c1ccc(-c2c[n+]3cccnc3[nH]2)cc1 |
| InChI | InChI=1S/C12H8N4O2/c17-16(18)10-4-2-9(3-5-10)11-8-15-7-1-6-13-12(15)14-11/h1-8H/p+1 |
| InChIKey | VUTPRDYSRJDBRS-UHFFFAOYSA-O |
| XLogP | 1.72 |
| TPSA | 75.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|