C12H8ClN3O7 — CID 139225257
2-(4-nitrophenyl)-[1,3]oxazolo[3,2-a]pyrimidin-4-ium perchlorate (PubChem CID 139225257) has the molecular formula C12H8ClN3O7 and a molecular weight of 341.66 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-[1,3]oxazolo[3,2-a]pyrimidin-4-ium perchlorate.
| Compound Name | 2-(4-nitrophenyl)-[1,3]oxazolo[3,2-a]pyrimidin-4-ium perchlorate |
|---|---|
| PubChem CID | 139225257 |
| Molecular Formula | C12H8ClN3O7 |
| Molecular Weight | 341.66 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | 2-(4-nitrophenyl)-[1,3]oxazolo[3,2-a]pyrimidin-4-ium perchlorate |
| SMILES | O=[N+]([O-])c1ccc(-c2c[n+]3cccnc3o2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C12H8N3O3.ClHO4/c16-15(17)10-4-2-9(3-5-10)11-8-14-7-1-6-13-12(14)18-11;2-1(3,4)5/h1-8H;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | DMLGFLFBDXMWJL-UHFFFAOYSA-M |
| XLogP | -2.77 |
| TPSA | 165.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.66 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|