C28H16N6O4S — CID 134693588
3-(4-nitrophenyl)-2-[[3-(4-nitrophenyl)-1,8-naphthyridin-2-yl]sulfanyl]-1,8-naphthyridine (PubChem CID 134693588) has the molecular formula C28H16N6O4S and a molecular weight of 532.54 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-2-[[3-(4-nitrophenyl)-1,8-naphthyridin-2-yl]sulfanyl]-1,8-naphthyridine.
| Compound Name | 3-(4-nitrophenyl)-2-[[3-(4-nitrophenyl)-1,8-naphthyridin-2-yl]sulfanyl]-1,8-naphthyridine |
|---|---|
| PubChem CID | 134693588 |
| Molecular Formula | C28H16N6O4S |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | 3-(4-nitrophenyl)-2-[[3-(4-nitrophenyl)-1,8-naphthyridin-2-yl]sulfanyl]-1,8-naphthyridine |
| SMILES | O=[N+]([O-])c1ccc(-c2cc3cccnc3nc2Sc2nc3ncccc3cc2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C28H16N6O4S/c35-33(36)21-9-5-17(6-10-21)23-15-19-3-1-13-29-25(19)31-27(23)39-28-24(16-20-4-2-14-30-26(20)32-28)18-7-11-22(12-8-18)34(37)38/h1-16H |
| InChIKey | RXCLGPJOFPWCDM-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 137.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|