C10H8N2O4 — CID 11252973
5-methoxy-2-(4-nitrophenyl)-1,3-oxazole (PubChem CID 11252973) has the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. Its IUPAC name is 5-methoxy-2-(4-nitrophenyl)-1,3-oxazole.
| Compound Name | 5-methoxy-2-(4-nitrophenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 11252973 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 5-methoxy-2-(4-nitrophenyl)-1,3-oxazole |
| SMILES | COc1cnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C10H8N2O4/c1-15-9-6-11-10(16-9)7-2-4-8(5-3-7)12(13)14/h2-6H,1H3 |
| InChIKey | BZYITYAYGLLSHD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 78.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|