C14H16N2O3 — CID 172704457
5-(2,2-dimethylpropyl)-2-(4-nitrophenyl)-1,3-oxazole (PubChem CID 172704457) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 5-(2,2-dimethylpropyl)-2-(4-nitrophenyl)-1,3-oxazole.
| Compound Name | 5-(2,2-dimethylpropyl)-2-(4-nitrophenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 172704457 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 5-(2,2-dimethylpropyl)-2-(4-nitrophenyl)-1,3-oxazole |
| SMILES | CC(C)(C)Cc1cnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C14H16N2O3/c1-14(2,3)8-12-9-15-13(19-12)10-4-6-11(7-5-10)16(17)18/h4-7,9H,8H2,1-3H3 |
| InChIKey | DJZDRMPQSTWHJR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|