C19H20N2O5 — CID 40762758
[2-[(2,3-dimethylphenyl)carbamoylamino]-2-oxoethyl] 3-methoxybenzoate (PubChem CID 40762758) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is [2-[(2,3-dimethylphenyl)carbamoylamino]-2-oxoethyl] 3-methoxybenzoate.
| Compound Name | [2-[(2,3-dimethylphenyl)carbamoylamino]-2-oxoethyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 40762758 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [2-[(2,3-dimethylphenyl)carbamoylamino]-2-oxoethyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OCC(=O)NC(=O)Nc2cccc(C)c2C)c1 |
| InChI | InChI=1S/C19H20N2O5/c1-12-6-4-9-16(13(12)2)20-19(24)21-17(22)11-26-18(23)14-7-5-8-15(10-14)25-3/h4-10H,11H2,1-3H3,(H2,20,21,22,24) |
| InChIKey | ZWTFCNKIWOXITK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |