methyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate

C18H19NO4 — CID 35986892

IUPACmethyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate
SMILESCOC(=O)c1cccc(OCC(=O)Nc2cccc(C)c2C)c1
InChIInChI=1S/C18H19NO4/c1-12-6-4-9-16(13(12)2)19-17(20)11-23-15-8-5-7-14(10-15)18(21)22-3/h4-10H,11H2,1-3H3,(H,19,20)
InChIKeyLBBJLJDFJPPKJM-UHFFFAOYSA-N
MW313.35 g/mol
LogP3.11
Rot. Bonds5

About methyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate

methyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate (PubChem CID 35986892) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is methyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate.

Molecular Properties

Compound Namemethyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate
PubChem CID35986892
Molecular FormulaC18H19NO4
Molecular Weight313.35 g/mol
Exact Mass313.13
IUPAC Namemethyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate
SMILESCOC(=O)c1cccc(OCC(=O)Nc2cccc(C)c2C)c1
InChIInChI=1S/C18H19NO4/c1-12-6-4-9-16(13(12)2)19-17(20)11-23-15-8-5-7-14(10-15)18(21)22-3/h4-10H,11H2,1-3H3,(H,19,20)
InChIKeyLBBJLJDFJPPKJM-UHFFFAOYSA-N
XLogP3.11
TPSA64.63 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.35
LogP ≤ 53.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate?
The IUPAC name of methyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate (CID 35986892) is methyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate.
What is the SMILES notation for methyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate?
The canonical SMILES for methyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate is COC(=O)c1cccc(OCC(=O)Nc2cccc(C)c2C)c1.
What is the InChIKey of methyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate?
The InChIKey is LBBJLJDFJPPKJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO4/c1-12-6-4-9-16(13(12)2)19-17(20)11-23-15-8-5-7-14(10-15)18(21)22-3/h4-10H,11H2,1-3H3,(H,19,20).
What are the key properties of methyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate?
methyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate has a molecular weight of 313.35 g/mol, XLogP of 3.11, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate is sourced from PubChem (CID 35986892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).