C18H19NO4 — CID 35986892
methyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate (PubChem CID 35986892) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is methyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate.
| Compound Name | methyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 35986892 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | methyl 3-[2-(2,3-dimethylanilino)-2-oxoethoxy]benzoate |
| SMILES | COC(=O)c1cccc(OCC(=O)Nc2cccc(C)c2C)c1 |
| InChI | InChI=1S/C18H19NO4/c1-12-6-4-9-16(13(12)2)19-17(20)11-23-15-8-5-7-14(10-15)18(21)22-3/h4-10H,11H2,1-3H3,(H,19,20) |
| InChIKey | LBBJLJDFJPPKJM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |