C24H27N3O5S — CID 4076357
benzyl N-[1-oxo-1-[[5-(propylsulfamoyl)naphthalen-1-yl]amino]propan-2-yl]carbamate (PubChem CID 4076357) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is benzyl N-[1-oxo-1-[[5-(propylsulfamoyl)naphthalen-1-yl]amino]propan-2-yl]carbamate.
| Compound Name | benzyl N-[1-oxo-1-[[5-(propylsulfamoyl)naphthalen-1-yl]amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 4076357 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | benzyl N-[1-oxo-1-[[5-(propylsulfamoyl)naphthalen-1-yl]amino]propan-2-yl]carbamate |
| SMILES | CCCNS(=O)(=O)c1cccc2c(NC(=O)C(C)NC(=O)OCc3ccccc3)cccc12 |
| InChI | InChI=1S/C24H27N3O5S/c1-3-15-25-33(30,31)22-14-8-11-19-20(22)12-7-13-21(19)27-23(28)17(2)26-24(29)32-16-18-9-5-4-6-10-18/h4-14,17,25H,3,15-16H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | DTFQHTJJPFLAMD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |