C27H35N3O2 — CID 40773778
(4R)-1-butyl-4-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one (PubChem CID 40773778) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is (4R)-1-butyl-4-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one.
| Compound Name | (4R)-1-butyl-4-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 40773778 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | (4R)-1-butyl-4-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one |
| SMILES | CCCCN1C[C@H](c2nc3ccccc3n2CCCCOc2cc(C)cc(C)c2)CC1=O |
| InChI | InChI=1S/C27H35N3O2/c1-4-5-12-29-19-22(18-26(29)31)27-28-24-10-6-7-11-25(24)30(27)13-8-9-14-32-23-16-20(2)15-21(3)17-23/h6-7,10-11,15-17,22H,4-5,8-9,12-14,18-19H2,1-3H3/t22-/m1/s1 |
| InChIKey | ZBVPUPNQSOHMAU-JOCHJYFZSA-N |
| XLogP | 5.63 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|