C21H27ClN4O3S2 — CID 40775882
5-chloro-N-[[4-(dimethylamino)phenyl]methyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-2-propylsulfanylpyrimidine-4-carboxamide (PubChem CID 40775882) has the molecular formula C21H27ClN4O3S2 and a molecular weight of 483.06 g/mol. Its IUPAC name is 5-chloro-N-[[4-(dimethylamino)phenyl]methyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-2-propylsulfanylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-[[4-(dimethylamino)phenyl]methyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-2-propylsulfanylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 40775882 |
| Molecular Formula | C21H27ClN4O3S2 |
| Molecular Weight | 483.06 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 5-chloro-N-[[4-(dimethylamino)phenyl]methyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-2-propylsulfanylpyrimidine-4-carboxamide |
| SMILES | CCCSc1ncc(Cl)c(C(=O)N(Cc2ccc(N(C)C)cc2)[C@@H]2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C21H27ClN4O3S2/c1-4-10-30-21-23-12-18(22)19(24-21)20(27)26(17-9-11-31(28,29)14-17)13-15-5-7-16(8-6-15)25(2)3/h5-8,12,17H,4,9-11,13-14H2,1-3H3/t17-/m1/s1 |
| InChIKey | AOJCWPCKBZJKSV-QGZVFWFLSA-N |
| XLogP | 3.53 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.06 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|