C23H28N6O4S — CID 40780891
1-[(3aR,4R,6R,7R,7aR)-6,7-dihydroxy-3-(4-pyrazol-1-ylphenyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carbonyl]piperidine-4-carboxamide (PubChem CID 40780891) has the molecular formula C23H28N6O4S and a molecular weight of 484.58 g/mol. Its IUPAC name is 1-[(3aR,4R,6R,7R,7aR)-6,7-dihydroxy-3-(4-pyrazol-1-ylphenyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3aR,4R,6R,7R,7aR)-6,7-dihydroxy-3-(4-pyrazol-1-ylphenyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 40780891 |
| Molecular Formula | C23H28N6O4S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 1-[(3aR,4R,6R,7R,7aR)-6,7-dihydroxy-3-(4-pyrazol-1-ylphenyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carbonyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)[C@@H]2C[C@@H](O)[C@H](O)[C@@H]3NC(=S)N(c4ccc(-n5cccn5)cc4)[C@@H]32)CC1 |
| InChI | InChI=1S/C23H28N6O4S/c24-21(32)13-6-10-27(11-7-13)22(33)16-12-17(30)20(31)18-19(16)29(23(34)26-18)15-4-2-14(3-5-15)28-9-1-8-25-28/h1-5,8-9,13,16-20,30-31H,6-7,10-12H2,(H2,24,32)(H,26,34)/t16-,17-,18-,19-,20+/m1/s1 |
| InChIKey | YHKGITOXZYQTDC-WAPOTWQKSA-N |
| XLogP | -0.23 |
| TPSA | 136.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|