C21H21F3N4O3S — CID 74736877
6,7-dihydroxy-N-(pyridin-3-ylmethyl)-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide (PubChem CID 74736877) has the molecular formula C21H21F3N4O3S and a molecular weight of 466.49 g/mol. Its IUPAC name is 6,7-dihydroxy-N-(pyridin-3-ylmethyl)-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide.
| Compound Name | 6,7-dihydroxy-N-(pyridin-3-ylmethyl)-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 74736877 |
| Molecular Formula | C21H21F3N4O3S |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 6,7-dihydroxy-N-(pyridin-3-ylmethyl)-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
| SMILES | O=C(NCc1cccnc1)C1CC(O)C(O)C2NC(=S)N(c3cccc(C(F)(F)F)c3)C12 |
| InChI | InChI=1S/C21H21F3N4O3S/c22-21(23,24)12-4-1-5-13(7-12)28-17-14(8-15(29)18(30)16(17)27-20(28)32)19(31)26-10-11-3-2-6-25-9-11/h1-7,9,14-18,29-30H,8,10H2,(H,26,31)(H,27,32) |
| InChIKey | KSDYALWLBFNZCC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|