C17H23F2N3O5 — CID 40781493
2-[(2S,3R,4S,5R)-5-[[(2,4-difluorophenyl)carbamoylamino]methyl]-3,4-dihydroxyoxolan-2-yl]-N-propan-2-ylacetamide (PubChem CID 40781493) has the molecular formula C17H23F2N3O5 and a molecular weight of 387.38 g/mol. Its IUPAC name is 2-[(2S,3R,4S,5R)-5-[[(2,4-difluorophenyl)carbamoylamino]methyl]-3,4-dihydroxyoxolan-2-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[(2S,3R,4S,5R)-5-[[(2,4-difluorophenyl)carbamoylamino]methyl]-3,4-dihydroxyoxolan-2-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 40781493 |
| Molecular Formula | C17H23F2N3O5 |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-[(2S,3R,4S,5R)-5-[[(2,4-difluorophenyl)carbamoylamino]methyl]-3,4-dihydroxyoxolan-2-yl]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)C[C@@H]1O[C@H](CNC(=O)Nc2ccc(F)cc2F)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H23F2N3O5/c1-8(2)21-14(23)6-12-15(24)16(25)13(27-12)7-20-17(26)22-11-4-3-9(18)5-10(11)19/h3-5,8,12-13,15-16,24-25H,6-7H2,1-2H3,(H,21,23)(H2,20,22,26)/t12-,13+,15-,16+/m0/s1 |
| InChIKey | IERHLIIHONHHAS-LQKXBSAESA-N |
| XLogP | 0.49 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |