C20H21BrF2N4O3 — CID 4079200
6-bromo-3-(2,6-difluorophenyl)-N-[3-(dimethylamino)propyl]-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide (PubChem CID 4079200) has the molecular formula C20H21BrF2N4O3 and a molecular weight of 483.31 g/mol. Its IUPAC name is 6-bromo-3-(2,6-difluorophenyl)-N-[3-(dimethylamino)propyl]-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide.
| Compound Name | 6-bromo-3-(2,6-difluorophenyl)-N-[3-(dimethylamino)propyl]-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide |
|---|---|
| PubChem CID | 4079200 |
| Molecular Formula | C20H21BrF2N4O3 |
| Molecular Weight | 483.31 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 6-bromo-3-(2,6-difluorophenyl)-N-[3-(dimethylamino)propyl]-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide |
| SMILES | CN(C)CCCNC(=O)C1(O)c2cc(Br)ccc2NC(=O)N1c1c(F)cccc1F |
| InChI | InChI=1S/C20H21BrF2N4O3/c1-26(2)10-4-9-24-18(28)20(30)13-11-12(21)7-8-16(13)25-19(29)27(20)17-14(22)5-3-6-15(17)23/h3,5-8,11,30H,4,9-10H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | VCQANUNQMQISCZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|