C26H28N2O3 — CID 40795104
4-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-N-phenylbenzamide (PubChem CID 40795104) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is 4-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-N-phenylbenzamide.
| Compound Name | 4-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 40795104 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 4-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-N-phenylbenzamide |
| SMILES | COc1ccc(OC)c([C@@H]2CCCN2Cc2ccc(C(=O)Nc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C26H28N2O3/c1-30-22-14-15-25(31-2)23(17-22)24-9-6-16-28(24)18-19-10-12-20(13-11-19)26(29)27-21-7-4-3-5-8-21/h3-5,7-8,10-15,17,24H,6,9,16,18H2,1-2H3,(H,27,29)/t24-/m0/s1 |
| InChIKey | NXERYDQSZQBZDA-DEOSSOPVSA-N |
| XLogP | 5.29 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |