C23H29N3O2 — CID 40796122
(2R,3S)-N-[4-(4-ethylpiperazin-1-yl)phenyl]-2,3-dimethyl-2,3-dihydro-1-benzofuran-7-carboxamide (PubChem CID 40796122) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is (2R,3S)-N-[4-(4-ethylpiperazin-1-yl)phenyl]-2,3-dimethyl-2,3-dihydro-1-benzofuran-7-carboxamide.
| Compound Name | (2R,3S)-N-[4-(4-ethylpiperazin-1-yl)phenyl]-2,3-dimethyl-2,3-dihydro-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 40796122 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | (2R,3S)-N-[4-(4-ethylpiperazin-1-yl)phenyl]-2,3-dimethyl-2,3-dihydro-1-benzofuran-7-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3cccc4c3O[C@H](C)[C@H]4C)cc2)CC1 |
| InChI | InChI=1S/C23H29N3O2/c1-4-25-12-14-26(15-13-25)19-10-8-18(9-11-19)24-23(27)21-7-5-6-20-16(2)17(3)28-22(20)21/h5-11,16-17H,4,12-15H2,1-3H3,(H,24,27)/t16-,17-/m1/s1 |
| InChIKey | DFEDGZZIOADYOC-IAGOWNOFSA-N |
| XLogP | 3.97 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|