C23H27N3O3S — CID 40799205
N-[2-(cyclohexen-1-yl)ethyl]-N'-[2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl]oxamide (PubChem CID 40799205) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N'-[2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl]oxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-[2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl]oxamide |
|---|---|
| PubChem CID | 40799205 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-[2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl]oxamide |
| SMILES | O=C(CNC(=O)C(=O)NCCC1=CCCCC1)N[C@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C23H27N3O3S/c27-20(26-21(19-12-7-15-30-19)18-10-5-2-6-11-18)16-25-23(29)22(28)24-14-13-17-8-3-1-4-9-17/h2,5-8,10-12,15,21H,1,3-4,9,13-14,16H2,(H,24,28)(H,25,29)(H,26,27)/t21-/m1/s1 |
| InChIKey | IJFYOHXEGAQLPI-OAQYLSRUSA-N |
| XLogP | 3.08 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|