C11H16N4O3 — CID 40801346
(3R)-3-amino-3-(2-morpholin-4-ylpyrimidin-5-yl)propanoic acid (PubChem CID 40801346) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is (3R)-3-amino-3-(2-morpholin-4-ylpyrimidin-5-yl)propanoic acid.
| Compound Name | (3R)-3-amino-3-(2-morpholin-4-ylpyrimidin-5-yl)propanoic acid |
|---|---|
| PubChem CID | 40801346 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (3R)-3-amino-3-(2-morpholin-4-ylpyrimidin-5-yl)propanoic acid |
| SMILES | N[C@H](CC(=O)O)c1cnc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C11H16N4O3/c12-9(5-10(16)17)8-6-13-11(14-7-8)15-1-3-18-4-2-15/h6-7,9H,1-5,12H2,(H,16,17)/t9-/m1/s1 |
| InChIKey | KSKVNTDCSRZNIL-SECBINFHSA-N |
| XLogP | -0.21 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |