C17H25BrN2O2 — CID 40803185
2-bromo-N-[3-[4-[(2R)-butan-2-yl]anilino]-3-oxopropyl]-2-methylpropanamide (PubChem CID 40803185) has the molecular formula C17H25BrN2O2 and a molecular weight of 369.30 g/mol. Its IUPAC name is 2-bromo-N-[3-[4-[(2R)-butan-2-yl]anilino]-3-oxopropyl]-2-methylpropanamide.
| Compound Name | 2-bromo-N-[3-[4-[(2R)-butan-2-yl]anilino]-3-oxopropyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 40803185 |
| Molecular Formula | C17H25BrN2O2 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 2-bromo-N-[3-[4-[(2R)-butan-2-yl]anilino]-3-oxopropyl]-2-methylpropanamide |
| SMILES | CC[C@@H](C)c1ccc(NC(=O)CCNC(=O)C(C)(C)Br)cc1 |
| InChI | InChI=1S/C17H25BrN2O2/c1-5-12(2)13-6-8-14(9-7-13)20-15(21)10-11-19-16(22)17(3,4)18/h6-9,12H,5,10-11H2,1-4H3,(H,19,22)(H,20,21)/t12-/m1/s1 |
| InChIKey | YFWAKTUQLXGDSZ-GFCCVEGCSA-N |
| XLogP | 3.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|