C19H23BrN2O2 — CID 40803252
(2S)-2-bromo-3,3-dimethyl-N-[3-(naphthalen-1-ylamino)-3-oxopropyl]butanamide (PubChem CID 40803252) has the molecular formula C19H23BrN2O2 and a molecular weight of 391.31 g/mol. Its IUPAC name is (2S)-2-bromo-3,3-dimethyl-N-[3-(naphthalen-1-ylamino)-3-oxopropyl]butanamide.
| Compound Name | (2S)-2-bromo-3,3-dimethyl-N-[3-(naphthalen-1-ylamino)-3-oxopropyl]butanamide |
|---|---|
| PubChem CID | 40803252 |
| Molecular Formula | C19H23BrN2O2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (2S)-2-bromo-3,3-dimethyl-N-[3-(naphthalen-1-ylamino)-3-oxopropyl]butanamide |
| SMILES | CC(C)(C)[C@H](Br)C(=O)NCCC(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C19H23BrN2O2/c1-19(2,3)17(20)18(24)21-12-11-16(23)22-15-10-6-8-13-7-4-5-9-14(13)15/h4-10,17H,11-12H2,1-3H3,(H,21,24)(H,22,23)/t17-/m1/s1 |
| InChIKey | YISMDHRCLNECQP-QGZVFWFLSA-N |
| XLogP | 4.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|