C22H34N2O2 — CID 145466012
1-(2,2-dimethyl-4-oxopentan-3-yl)-3-naphthalen-1-ylurea;ethane (PubChem CID 145466012) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 1-(2,2-dimethyl-4-oxopentan-3-yl)-3-naphthalen-1-ylurea;ethane.
| Compound Name | 1-(2,2-dimethyl-4-oxopentan-3-yl)-3-naphthalen-1-ylurea;ethane |
|---|---|
| PubChem CID | 145466012 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | 1-(2,2-dimethyl-4-oxopentan-3-yl)-3-naphthalen-1-ylurea;ethane |
| SMILES | CC.CC.CC(=O)C(NC(=O)Nc1cccc2ccccc12)C(C)(C)C |
| InChI | InChI=1S/C18H22N2O2.2C2H6/c1-12(21)16(18(2,3)4)20-17(22)19-15-11-7-9-13-8-5-6-10-14(13)15;2*1-2/h5-11,16H,1-4H3,(H2,19,20,22);2*1-2H3 |
| InChIKey | BWYLUDOUSVHQSU-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |