C14H13N3O — CID 54904343
1-(1-cyanoethyl)-3-naphthalen-1-ylurea (PubChem CID 54904343) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is 1-(1-cyanoethyl)-3-naphthalen-1-ylurea.
| Compound Name | 1-(1-cyanoethyl)-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 54904343 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 1-(1-cyanoethyl)-3-naphthalen-1-ylurea |
| SMILES | CC(C#N)NC(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C14H13N3O/c1-10(9-15)16-14(18)17-13-8-4-6-11-5-2-3-7-12(11)13/h2-8,10H,1H3,(H2,16,17,18) |
| InChIKey | YIMRIRPSRXLZBY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |