C10H10N2O3 — CID 40805098
methyl N-(2-oxo-1,3-dihydroindol-5-yl)carbamate (PubChem CID 40805098) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is methyl N-(2-oxo-1,3-dihydroindol-5-yl)carbamate.
| Compound Name | methyl N-(2-oxo-1,3-dihydroindol-5-yl)carbamate |
|---|---|
| PubChem CID | 40805098 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | methyl N-(2-oxo-1,3-dihydroindol-5-yl)carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C10H10N2O3/c1-15-10(14)11-7-2-3-8-6(4-7)5-9(13)12-8/h2-4H,5H2,1H3,(H,11,14)(H,12,13) |
| InChIKey | OHQBEJBLQOACHX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |