C18H23N5O3S3 — CID 40808922
2-[[2-[[5-[[(2S)-oxolan-2-yl]methylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 40808922) has the molecular formula C18H23N5O3S3 and a molecular weight of 453.62 g/mol. Its IUPAC name is 2-[[2-[[5-[[(2S)-oxolan-2-yl]methylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[[5-[[(2S)-oxolan-2-yl]methylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 40808922 |
| Molecular Formula | C18H23N5O3S3 |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 2-[[2-[[5-[[(2S)-oxolan-2-yl]methylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)CSc2nnc(NC[C@@H]3CCCO3)s2)sc2c1CCCC2 |
| InChI | InChI=1S/C18H23N5O3S3/c19-15(25)14-11-5-1-2-6-12(11)28-16(14)21-13(24)9-27-18-23-22-17(29-18)20-8-10-4-3-7-26-10/h10H,1-9H2,(H2,19,25)(H,20,22)(H,21,24)/t10-/m0/s1 |
| InChIKey | QEIHCDQETSNIOT-JTQLQIEISA-N |
| XLogP | 2.90 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |