C16H21N5O3S3 — CID 17490482
2-[[2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 17490482) has the molecular formula C16H21N5O3S3 and a molecular weight of 427.58 g/mol. Its IUPAC name is 2-[[2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 17490482 |
| Molecular Formula | C16H21N5O3S3 |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 2-[[2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COCCNc1nnc(SCC(=O)Nc2sc3c(c2C(N)=O)CCCC3)s1 |
| InChI | InChI=1S/C16H21N5O3S3/c1-24-7-6-18-15-20-21-16(27-15)25-8-11(22)19-14-12(13(17)23)9-4-2-3-5-10(9)26-14/h2-8H2,1H3,(H2,17,23)(H,18,20)(H,19,22) |
| InChIKey | VVVCQUMUURCLFM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|