C20H26N4O4S3 — CID 23736239
ethyl 2-[[2-[[5-(2-methylpropanoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 23736239) has the molecular formula C20H26N4O4S3 and a molecular weight of 482.65 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-(2-methylpropanoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-(2-methylpropanoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 23736239 |
| Molecular Formula | C20H26N4O4S3 |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | ethyl 2-[[2-[[5-(2-methylpropanoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2nnc(NC(=O)C(C)C)s2)sc2c1CCCCC2 |
| InChI | InChI=1S/C20H26N4O4S3/c1-4-28-18(27)15-12-8-6-5-7-9-13(12)30-17(15)21-14(25)10-29-20-24-23-19(31-20)22-16(26)11(2)3/h11H,4-10H2,1-3H3,(H,21,25)(H,22,23,26) |
| InChIKey | NRQBNCIEOININR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|