C15H10ClN3O6 — CID 4081357
N-(3-chlorophenyl)-3-(2,6-dinitrophenyl)-2-oxopropanamide (PubChem CID 4081357) has the molecular formula C15H10ClN3O6 and a molecular weight of 363.71 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-(2,6-dinitrophenyl)-2-oxopropanamide.
| Compound Name | N-(3-chlorophenyl)-3-(2,6-dinitrophenyl)-2-oxopropanamide |
|---|---|
| PubChem CID | 4081357 |
| Molecular Formula | C15H10ClN3O6 |
| Molecular Weight | 363.71 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | N-(3-chlorophenyl)-3-(2,6-dinitrophenyl)-2-oxopropanamide |
| SMILES | O=C(Cc1c([N+](=O)[O-])cccc1[N+](=O)[O-])C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H10ClN3O6/c16-9-3-1-4-10(7-9)17-15(21)14(20)8-11-12(18(22)23)5-2-6-13(11)19(24)25/h1-7H,8H2,(H,17,21) |
| InChIKey | NBQUQSCGAPZIOO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.71 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|