C34H40ClN5O3S2 — CID 4081372
6-(4-chlorophenyl)-N-(2,3-dimethylcyclohexyl)-2-(3-morpholin-4-ylsulfonylphenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 4081372) has the molecular formula C34H40ClN5O3S2 and a molecular weight of 666.31 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N-(2,3-dimethylcyclohexyl)-2-(3-morpholin-4-ylsulfonylphenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | 6-(4-chlorophenyl)-N-(2,3-dimethylcyclohexyl)-2-(3-morpholin-4-ylsulfonylphenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 4081372 |
| Molecular Formula | C34H40ClN5O3S2 |
| Molecular Weight | 666.31 g/mol |
| Exact Mass | 665.23 |
| IUPAC Name | 6-(4-chlorophenyl)-N-(2,3-dimethylcyclohexyl)-2-(3-morpholin-4-ylsulfonylphenyl)-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | CC1CCCC(NC(=S)c2c(-c3ccc(Cl)cc3)c3c4n(c(-c5cccc(S(=O)(=O)N6CCOCC6)c5)nn24)CCCC3)C1C |
| InChI | InChI=1S/C34H40ClN5O3S2/c1-22-7-5-11-29(23(22)2)36-33(44)31-30(24-12-14-26(35)15-13-24)28-10-3-4-16-39-32(37-40(31)34(28)39)25-8-6-9-27(21-25)45(41,42)38-17-19-43-20-18-38/h6,8-9,12-15,21-23,29H,3-5,7,10-11,16-20H2,1-2H3,(H,36,44) |
| InChIKey | KEYRIWYLUIYZRQ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.31 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|