C34H34ClN5O3S2 — CID 99670724
6-(4-chlorophenyl)-2-(3-morpholin-4-ylsulfonylphenyl)-N-[(1R)-1-phenylethyl]-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide (PubChem CID 99670724) has the molecular formula C34H34ClN5O3S2 and a molecular weight of 660.27 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-(3-morpholin-4-ylsulfonylphenyl)-N-[(1R)-1-phenylethyl]-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide.
| Compound Name | 6-(4-chlorophenyl)-2-(3-morpholin-4-ylsulfonylphenyl)-N-[(1R)-1-phenylethyl]-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
|---|---|
| PubChem CID | 99670724 |
| Molecular Formula | C34H34ClN5O3S2 |
| Molecular Weight | 660.27 g/mol |
| Exact Mass | 659.18 |
| IUPAC Name | 6-(4-chlorophenyl)-2-(3-morpholin-4-ylsulfonylphenyl)-N-[(1R)-1-phenylethyl]-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioamide |
| SMILES | C[C@@H](NC(=S)c1c(-c2ccc(Cl)cc2)c2c3n(c(-c4cccc(S(=O)(=O)N5CCOCC5)c4)nn13)CCCC2)c1ccccc1 |
| InChI | InChI=1S/C34H34ClN5O3S2/c1-23(24-8-3-2-4-9-24)36-33(44)31-30(25-13-15-27(35)16-14-25)29-12-5-6-17-39-32(37-40(31)34(29)39)26-10-7-11-28(22-26)45(41,42)38-18-20-43-21-19-38/h2-4,7-11,13-16,22-23H,5-6,12,17-21H2,1H3,(H,36,44)/t23-/m1/s1 |
| InChIKey | CVWRIAYMWUORSP-HSZRJFAPSA-N |
| XLogP | 6.51 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.27 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|